![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| PicoGreen DETAMB.doc | 2015-09-22 10:20 | 21K | |
| Modulus™ Microplate Fluorometer Method for DNA Quantitation Using qUANTI6IT PICOGREEN DSdna KIT.pdf | 2015-09-22 10:20 | 59K | |
| PicoGreen Assay.pdf | 2015-09-22 10:20 | 60K | |
| Ahn et al 1996 PicoGreen quantitation of DNA.pdf | 2015-09-22 10:20 | 71K | |
| TN_PicoGreenDNA.pdf | 2015-09-22 10:20 | 139K | |
| Quant-iT™ PicoGreen ® dsDNA Reagent and Kits.pdf | 2015-09-22 10:20 | 147K | |